ChemNet > CAS > 337508-64-2 5-phenyl-1,3-oxazole-4-carbonyl chloride
337508-64-2 5-phenyl-1,3-oxazole-4-carbonyl chloride
Nama produk |
5-phenyl-1,3-oxazole-4-carbonyl chloride |
Sinonim |
5-phenyloxazole-4-carbonyl chloride |
MF |
C10H6ClNO2 |
Berat Molekul |
207.6131 |
InChI |
InChI=1/C10H6ClNO2/c11-10(13)8-9(14-6-12-8)7-4-2-1-3-5-7/h1-6H |
CAS NO |
337508-64-2 |
Struktur Molekul |
|
Kepadatan |
1.321g/cm3 |
Titik lebur |
68℃ |
Titik didih |
357.187°C at 760 mmHg |
Indeks bias |
1.569 |
Titik nyala |
169.821°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|